C25H28O3S — CID 88791607
[1-(3-phenoxyphenyl)-2-sulfanylidenepropyl] 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 88791607) has the molecular formula C25H28O3S and a molecular weight of 408.56 g/mol. Its IUPAC name is [1-(3-phenoxyphenyl)-2-sulfanylidenepropyl] 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | [1-(3-phenoxyphenyl)-2-sulfanylidenepropyl] 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88791607 |
| Molecular Formula | C25H28O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [1-(3-phenoxyphenyl)-2-sulfanylidenepropyl] 2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CC(=S)C(OC(=O)C1(C=C(C)C)CC1(C)C)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H28O3S/c1-17(2)15-25(16-24(25,4)5)23(26)28-22(18(3)29)19-10-9-13-21(14-19)27-20-11-7-6-8-12-20/h6-15,22H,16H2,1-5H3 |
| InChIKey | QJZWOSWYGDZTDT-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|