C15H18O4 — CID 118037345
trans-benzyl (1R,3S)-3-formyloxy-2,2-dimethylcyclobutane-1-carboxylate (PubChem CID 118037345) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is trans-benzyl (1R,3S)-3-formyloxy-2,2-dimethylcyclobutane-1-carboxylate.
| Compound Name | trans-benzyl (1R,3S)-3-formyloxy-2,2-dimethylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 118037345 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | trans-benzyl (1R,3S)-3-formyloxy-2,2-dimethylcyclobutane-1-carboxylate |
| SMILES | CC1(C)[C@@H](OC=O)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-15(2)12(8-13(15)19-10-16)14(17)18-9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | WTGOKIBRIMBORG-STQMWFEESA-N |
| XLogP | 2.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|