benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate

C16H18O3 — CID 142754722

IUPACbenzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate
SMILESCC(=O)C=CC1CC(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C16H18O3/c1-12(17)7-8-14-9-15(10-14)16(18)19-11-13-5-3-2-4-6-13/h2-8,14-15H,9-11H2,1H3
InChIKeyAVPGJZSLPSIVPU-UHFFFAOYSA-N
MW258.32 g/mol
LogP2.90
Rot. Bonds5

About benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate

benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate (PubChem CID 142754722) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate.

Molecular Properties

Compound Namebenzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate
PubChem CID142754722
Molecular FormulaC16H18O3
Molecular Weight258.32 g/mol
Exact Mass258.13
IUPAC Namebenzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate
SMILESCC(=O)C=CC1CC(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C16H18O3/c1-12(17)7-8-14-9-15(10-14)16(18)19-11-13-5-3-2-4-6-13/h2-8,14-15H,9-11H2,1H3
InChIKeyAVPGJZSLPSIVPU-UHFFFAOYSA-N
XLogP2.90
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.32
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate?
The IUPAC name of benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate (CID 142754722) is benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate.
What is the SMILES notation for benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate?
The canonical SMILES for benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate is CC(=O)C=CC1CC(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate?
The InChIKey is AVPGJZSLPSIVPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O3/c1-12(17)7-8-14-9-15(10-14)16(18)19-11-13-5-3-2-4-6-13/h2-8,14-15H,9-11H2,1H3.
What are the key properties of benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate?
benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate has a molecular weight of 258.32 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(3-oxobut-1-enyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 142754722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).