C8H10Br3O2- — CID 22564703
2,2-dimethyl-3-(2,2,2-tribromoethyl)cyclopropane-1-carboxylate (PubChem CID 22564703) has the molecular formula C8H10Br3O2- and a molecular weight of 377.88 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,2,2-tribromoethyl)cyclopropane-1-carboxylate.
| Compound Name | 2,2-dimethyl-3-(2,2,2-tribromoethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 22564703 |
| Molecular Formula | C8H10Br3O2- |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 374.82 |
| IUPAC Name | 2,2-dimethyl-3-(2,2,2-tribromoethyl)cyclopropane-1-carboxylate |
| SMILES | CC1(C)C(CC(Br)(Br)Br)C1C(=O)[O-] |
| InChI | InChI=1S/C8H11Br3O2/c1-7(2)4(3-8(9,10)11)5(7)6(12)13/h4-5H,3H2,1-2H3,(H,12,13)/p-1 |
| InChIKey | FKKGAYQYTJBFPX-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|