C9H11Br2O3- — CID 19025111
3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 19025111) has the molecular formula C9H11Br2O3- and a molecular weight of 326.99 g/mol. Its IUPAC name is 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 19025111 |
| Molecular Formula | C9H11Br2O3- |
| Molecular Weight | 326.99 g/mol |
| Exact Mass | 324.91 |
| IUPAC Name | 3-(1,3-dibromo-2-oxopropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)[O-])C1C(Br)C(=O)CBr |
| InChI | InChI=1S/C9H12Br2O3/c1-9(2)5(6(9)8(13)14)7(11)4(12)3-10/h5-7H,3H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | CPXNOISJVNQSFW-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.99 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|