About sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate
sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 23686973) has the molecular formula C7H11NaO3
and a molecular weight of 166.15 g/mol. Its IUPAC name is sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate.
Analyze sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate (CID 23686973) is sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate is CC1(C)C(CO)C1C(=O)[O-].[Na+].
What is the InChIKey of sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is ZDUFOLBUBAHTJI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O3.Na/c1-7(2)4(3-8)5(7)6(9)10;/h4-5,8H,3H2,1-2H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 166.15 g/mol, XLogP of -4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(hydroxymethyl)-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 23686973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).