C9H11Cl3O3 — CID 87119669
2,2,2-trichloroethyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 87119669) has the molecular formula C9H11Cl3O3 and a molecular weight of 273.54 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 87119669 |
| Molecular Formula | C9H11Cl3O3 |
| Molecular Weight | 273.54 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2,2,2-trichloroethyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=O)C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11Cl3O3/c1-8(2)5(3-13)6(8)7(14)15-4-9(10,11)12/h3,5-6H,4H2,1-2H3 |
| InChIKey | SMVXPDFVMHDGAH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|