C9H14O4 — CID 13272137
trans-methoxymethyl (1R,3S)-3-formyl-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 13272137) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is trans-methoxymethyl (1R,3S)-3-formyl-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-methoxymethyl (1R,3S)-3-formyl-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13272137 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | trans-methoxymethyl (1R,3S)-3-formyl-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COCOC(=O)[C@@H]1[C@H](C=O)C1(C)C |
| InChI | InChI=1S/C9H14O4/c1-9(2)6(4-10)7(9)8(11)13-5-12-3/h4,6-7H,5H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | KFFVXKYZOZIFPM-BQBZGAKWSA-N |
| XLogP | 0.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|