C19H32O6 — CID 57110115
cis-methoxymethyl (1R,3R)-3-[2,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 57110115) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is cis-methoxymethyl (1R,3R)-3-[2,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-methoxymethyl (1R,3R)-3-[2,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57110115 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | cis-methoxymethyl (1R,3R)-3-[2,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COCOC(=O)[C@@H]1[C@@H](C=C(OC(C)(C)C)C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C19H32O6/c1-17(2,3)24-13(15(20)25-18(4,5)6)10-12-14(19(12,7)8)16(21)23-11-22-9/h10,12,14H,11H2,1-9H3/t12-,14+/m1/s1 |
| InChIKey | IASCQAUQCHWKHT-OCCSQVGLSA-N |
| XLogP | 3.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|