C17H30N2O3 — CID 97022054
tert-butyl N-[2-[[(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]ethyl]carbamate (PubChem CID 97022054) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 97022054 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tert-butyl N-[2-[[(1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)=C[C@H]1[C@@H](C(=O)NCCNC(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C17H30N2O3/c1-11(2)10-12-13(17(12,6)7)14(20)18-8-9-19-15(21)22-16(3,4)5/h10,12-13H,8-9H2,1-7H3,(H,18,20)(H,19,21)/t12-,13-/m0/s1 |
| InChIKey | AFINWELGYNDIDK-STQMWFEESA-N |
| XLogP | 2.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|