C18H24FNO — CID 24625156
N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 24625156) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 24625156 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)=CC1C(C(=O)NCCc2ccccc2F)C1(C)C |
| InChI | InChI=1S/C18H24FNO/c1-12(2)11-14-16(18(14,3)4)17(21)20-10-9-13-7-5-6-8-15(13)19/h5-8,11,14,16H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | XNQYXLTVQCYMSX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|