C20H29NO3 — CID 24559554
N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 24559554) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 24559554 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2C(C=C(C)C)C2(C)C)cc1OC |
| InChI | InChI=1S/C20H29NO3/c1-13(2)11-15-18(20(15,3)4)19(22)21-10-9-14-7-8-16(23-5)17(12-14)24-6/h7-8,11-12,15,18H,9-10H2,1-6H3,(H,21,22) |
| InChIKey | CZPFLWBMDQACDT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|