C12H22N2O3S — CID 94657623
trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-(2-sulfamoylethyl)cyclopropane-1-carboxamide (PubChem CID 94657623) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-(2-sulfamoylethyl)cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-(2-sulfamoylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94657623 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | trans-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)-N-(2-sulfamoylethyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)=C[C@@H]1[C@H](C(=O)NCCS(N)(=O)=O)C1(C)C |
| InChI | InChI=1S/C12H22N2O3S/c1-8(2)7-9-10(12(9,3)4)11(15)14-5-6-18(13,16)17/h7,9-10H,5-6H2,1-4H3,(H,14,15)(H2,13,16,17)/t9-,10-/m1/s1 |
| InChIKey | YKUGLSJZQLFQPJ-NXEZZACHSA-N |
| XLogP | 0.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|