C13H23NO2 — CID 94181241
cis-(1S,3S)-N-(2-methoxyethyl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 94181241) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is cis-(1S,3S)-N-(2-methoxyethyl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1S,3S)-N-(2-methoxyethyl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94181241 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | cis-(1S,3S)-N-(2-methoxyethyl)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | COCCNC(=O)[C@H]1[C@H](C=C(C)C)C1(C)C |
| InChI | InChI=1S/C13H23NO2/c1-9(2)8-10-11(13(10,3)4)12(15)14-6-7-16-5/h8,10-11H,6-7H2,1-5H3,(H,14,15)/t10-,11+/m0/s1 |
| InChIKey | MCFAAWNMLVCPCC-WDEREUQCSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|