C25H30N2O3 — CID 7330881
2-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-(2-phenoxyethyl)benzamide (PubChem CID 7330881) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-(2-phenoxyethyl)benzamide.
| Compound Name | 2-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 7330881 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 2-[[(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]amino]-N-(2-phenoxyethyl)benzamide |
| SMILES | CC(C)=C[C@@H]1[C@H](C(=O)Nc2ccccc2C(=O)NCCOc2ccccc2)C1(C)C |
| InChI | InChI=1S/C25H30N2O3/c1-17(2)16-20-22(25(20,3)4)24(29)27-21-13-9-8-12-19(21)23(28)26-14-15-30-18-10-6-5-7-11-18/h5-13,16,20,22H,14-15H2,1-4H3,(H,26,28)(H,27,29)/t20-,22-/m1/s1 |
| InChIKey | RVFACBFRVKGFPG-IFMALSPDSA-N |
| XLogP | 4.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|