C21H32N2O — CID 60566304
2,2-dimethyl-N-[4-(N-methylanilino)butyl]-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 60566304) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(N-methylanilino)butyl]-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dimethyl-N-[4-(N-methylanilino)butyl]-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 60566304 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 2,2-dimethyl-N-[4-(N-methylanilino)butyl]-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)=CC1C(C(=O)NCCCCN(C)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C21H32N2O/c1-16(2)15-18-19(21(18,3)4)20(24)22-13-9-10-14-23(5)17-11-7-6-8-12-17/h6-8,11-12,15,18-19H,9-10,13-14H2,1-5H3,(H,22,24) |
| InChIKey | ZCPAHDQDKSFPLY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|