C16H26N4 — CID 111078637
1-[4-(N-methylanilino)butyl]-2-(2-methylprop-2-enyl)guanidine (PubChem CID 111078637) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-[4-(N-methylanilino)butyl]-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-[4-(N-methylanilino)butyl]-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111078637 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 1-[4-(N-methylanilino)butyl]-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C16H26N4/c1-14(2)13-19-16(17)18-11-7-8-12-20(3)15-9-5-4-6-10-15/h4-6,9-10H,1,7-8,11-13H2,2-3H3,(H3,17,18,19) |
| InChIKey | FCPFLYJMEHIHPR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|