C12H26N4 — CID 111025406
1-[3-(diethylamino)propyl]-2-(2-methylprop-2-enyl)guanidine (PubChem CID 111025406) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-2-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1-[3-(diethylamino)propyl]-2-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 111025406 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-2-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCCN(CC)CC |
| InChI | InChI=1S/C12H26N4/c1-5-16(6-2)9-7-8-14-12(13)15-10-11(3)4/h3,5-10H2,1-2,4H3,(H3,13,14,15) |
| InChIKey | MOTHKXZIIAJJHI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|