C7H10Cl2O2 — CID 20528815
3-(dichloromethyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 20528815) has the molecular formula C7H10Cl2O2 and a molecular weight of 197.06 g/mol. Its IUPAC name is 3-(dichloromethyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-(dichloromethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 20528815 |
| Molecular Formula | C7H10Cl2O2 |
| Molecular Weight | 197.06 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 3-(dichloromethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C(=O)O)C1C(Cl)Cl |
| InChI | InChI=1S/C7H10Cl2O2/c1-7(2)3(5(8)9)4(7)6(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | IBXVFEMFZMPAFY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.06 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|