About propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid
propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid (PubChem CID 54020889) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid |
| PubChem CID | 54020889 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid |
| SMILES | CC(C)N.C[C@@H]1C(C(=O)O)C1(C)C |
| InChI | InChI=1S/C7H12O2.C3H9N/c1-4-5(6(8)9)7(4,2)3;1-3(2)4/h4-5H,1-3H3,(H,8,9);3H,4H2,1-2H3/t4-,5?;/m1./s1 |
| InChIKey | KYVODVPWYPDRNP-FVYOBFAJSA-N |
| XLogP | 1.72 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid?
The IUPAC name of propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid (CID 54020889) is propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid.
What is the SMILES notation for propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid?
The canonical SMILES for propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid is CC(C)N.C[C@@H]1C(C(=O)O)C1(C)C.
What is the InChIKey of propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid?
The InChIKey is KYVODVPWYPDRNP-FVYOBFAJSA-N. The full InChI is InChI=1S/C7H12O2.C3H9N/c1-4-5(6(8)9)7(4,2)3;1-3(2)4/h4-5H,1-3H3,(H,8,9);3H,4H2,1-2H3/t4-,5?;/m1./s1.
What are the key properties of propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid?
propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid has a molecular weight of 187.28 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine;(3R)-2,2,3-trimethylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 54020889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).