C14H14Cl4O2 — CID 13080565
2,2-dimethyl-3-[1,2,2-trichloro-2-(4-chlorophenyl)ethyl]cyclopropane-1-carboxylic acid (PubChem CID 13080565) has the molecular formula C14H14Cl4O2 and a molecular weight of 356.08 g/mol. Its IUPAC name is 2,2-dimethyl-3-[1,2,2-trichloro-2-(4-chlorophenyl)ethyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-3-[1,2,2-trichloro-2-(4-chlorophenyl)ethyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 13080565 |
| Molecular Formula | C14H14Cl4O2 |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2,2-dimethyl-3-[1,2,2-trichloro-2-(4-chlorophenyl)ethyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C(=O)O)C1C(Cl)C(Cl)(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14Cl4O2/c1-13(2)9(10(13)12(19)20)11(16)14(17,18)7-3-5-8(15)6-4-7/h3-6,9-11H,1-2H3,(H,19,20) |
| InChIKey | WVUZEKMMBDVAKW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|