About bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate
bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate (PubChem CID 88550141) has the molecular formula C14H27O10P
and a molecular weight of 386.33 g/mol. Its IUPAC name is bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate.
Molecular Properties
| Compound Name | bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate |
| PubChem CID | 88550141 |
| Molecular Formula | C14H27O10P |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate |
| SMILES | CCOP(=O)(OCC)OC(CC(=O)OCCOC)C(=O)OCCOC |
| InChI | InChI=1S/C14H27O10P/c1-5-22-25(17,23-6-2)24-12(14(16)21-10-8-19-4)11-13(15)20-9-7-18-3/h12H,5-11H2,1-4H3 |
| InChIKey | LVNKYCSSVLJZCU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate?
The IUPAC name of bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate (CID 88550141) is bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate.
What is the SMILES notation for bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate?
The canonical SMILES for bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate is CCOP(=O)(OCC)OC(CC(=O)OCCOC)C(=O)OCCOC.
What is the InChIKey of bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate?
The InChIKey is LVNKYCSSVLJZCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27O10P/c1-5-22-25(17,23-6-2)24-12(14(16)21-10-8-19-4)11-13(15)20-9-7-18-3/h12H,5-11H2,1-4H3.
What are the key properties of bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate?
bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate has a molecular weight of 386.33 g/mol, XLogP of 1.32, 15 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyethyl) 2-diethoxyphosphoryloxybutanedioate is sourced from PubChem (CID 88550141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).