C35H44NO6PS — CID 101110086
(2-sulfanylidene-1-pyridinyl) (E)-3-diethoxyphosphoryl-9-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylnon-8-enoate (PubChem CID 101110086) has the molecular formula C35H44NO6PS and a molecular weight of 637.78 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) (E)-3-diethoxyphosphoryl-9-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylnon-8-enoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) (E)-3-diethoxyphosphoryl-9-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylnon-8-enoate |
|---|---|
| PubChem CID | 101110086 |
| Molecular Formula | C35H44NO6PS |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) (E)-3-diethoxyphosphoryl-9-(2,2-diphenylcyclopropyl)-2-methoxy-2-methylnon-8-enoate |
| SMILES | CCOP(=O)(OCC)C(CCCC/C=C/C1CC1(c1ccccc1)c1ccccc1)C(C)(OC)C(=O)On1ccccc1=S |
| InChI | InChI=1S/C35H44NO6PS/c1-5-40-43(38,41-6-2)31(34(3,39-4)33(37)42-36-26-18-17-25-32(36)44)24-16-8-7-11-23-30-27-35(30,28-19-12-9-13-20-28)29-21-14-10-15-22-29/h9-15,17-23,25-26,30-31H,5-8,16,24,27H2,1-4H3/b23-11+ |
| InChIKey | UVTRAYJWDAKXMU-FOKLQQMPSA-N |
| XLogP | 8.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|