C31H38NO7PS — CID 101182075
(2-sulfanylidene-1-pyridinyl) 3-diethoxyphosphoryloxy-2-methoxy-2-methyl-8,8-diphenyloct-7-enoate (PubChem CID 101182075) has the molecular formula C31H38NO7PS and a molecular weight of 599.69 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 3-diethoxyphosphoryloxy-2-methoxy-2-methyl-8,8-diphenyloct-7-enoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 3-diethoxyphosphoryloxy-2-methoxy-2-methyl-8,8-diphenyloct-7-enoate |
|---|---|
| PubChem CID | 101182075 |
| Molecular Formula | C31H38NO7PS |
| Molecular Weight | 599.69 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 3-diethoxyphosphoryloxy-2-methoxy-2-methyl-8,8-diphenyloct-7-enoate |
| SMILES | CCOP(=O)(OCC)OC(CCCC=C(c1ccccc1)c1ccccc1)C(C)(OC)C(=O)On1ccccc1=S |
| InChI | InChI=1S/C31H38NO7PS/c1-5-36-40(34,37-6-2)39-28(31(3,35-4)30(33)38-32-24-16-15-23-29(32)41)22-14-13-21-27(25-17-9-7-10-18-25)26-19-11-8-12-20-26/h7-12,15-21,23-24,28H,5-6,13-14,22H2,1-4H3 |
| InChIKey | CRGBYKMBOWNPQA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.69 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|