C22H27NO3 — CID 86740123
methyl (E)-2-(2-hydroxypropan-2-yl)-7-phenyl-7-pyridin-3-ylhept-6-enoate (PubChem CID 86740123) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl (E)-2-(2-hydroxypropan-2-yl)-7-phenyl-7-pyridin-3-ylhept-6-enoate.
| Compound Name | methyl (E)-2-(2-hydroxypropan-2-yl)-7-phenyl-7-pyridin-3-ylhept-6-enoate |
|---|---|
| PubChem CID | 86740123 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | methyl (E)-2-(2-hydroxypropan-2-yl)-7-phenyl-7-pyridin-3-ylhept-6-enoate |
| SMILES | COC(=O)C(CCC/C=C(\c1ccccc1)c1cccnc1)C(C)(C)O |
| InChI | InChI=1S/C22H27NO3/c1-22(2,25)20(21(24)26-3)14-8-7-13-19(17-10-5-4-6-11-17)18-12-9-15-23-16-18/h4-6,9-13,15-16,20,25H,7-8,14H2,1-3H3/b19-13+ |
| InChIKey | OCWDNCZUHZFEMB-CPNJWEJPSA-N |
| XLogP | 4.24 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|