C33H45NO5 — CID 15550884
diethyl 2-(5,5-diphenylpent-4-enyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate (PubChem CID 15550884) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is diethyl 2-(5,5-diphenylpent-4-enyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate.
| Compound Name | diethyl 2-(5,5-diphenylpent-4-enyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate |
|---|---|
| PubChem CID | 15550884 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | diethyl 2-(5,5-diphenylpent-4-enyl)-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate |
| SMILES | CCOC(=O)C(CCCC=C(c1ccccc1)c1ccccc1)(ON1C(C)(C)CCCC1(C)C)C(=O)OCC |
| InChI | InChI=1S/C33H45NO5/c1-7-37-29(35)33(30(36)38-8-2,39-34-31(3,4)23-17-24-32(34,5)6)25-16-15-22-28(26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-14,18-22H,7-8,15-17,23-25H2,1-6H3 |
| InChIKey | FUSPPHWXBKSGOF-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|