C22H39NO6 — CID 11101730
diethyl 2-[(E)-5-methoxypent-4-enyl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate (PubChem CID 11101730) has the molecular formula C22H39NO6 and a molecular weight of 413.56 g/mol. Its IUPAC name is diethyl 2-[(E)-5-methoxypent-4-enyl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate.
| Compound Name | diethyl 2-[(E)-5-methoxypent-4-enyl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate |
|---|---|
| PubChem CID | 11101730 |
| Molecular Formula | C22H39NO6 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | diethyl 2-[(E)-5-methoxypent-4-enyl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanedioate |
| SMILES | CCOC(=O)C(CCC/C=C/OC)(ON1C(C)(C)CCCC1(C)C)C(=O)OCC |
| InChI | InChI=1S/C22H39NO6/c1-8-27-18(24)22(19(25)28-9-2,16-11-10-12-17-26-7)29-23-20(3,4)14-13-15-21(23,5)6/h12,17H,8-11,13-16H2,1-7H3/b17-12+ |
| InChIKey | SPSJZSPIUYFBHH-SFQUDFHCSA-N |
| XLogP | 4.16 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|