C22H37NO6 — CID 71480410
diethyl 2-[(1S,2S)-1-cyclopropyl-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropyl]propanedioate (PubChem CID 71480410) has the molecular formula C22H37NO6 and a molecular weight of 411.54 g/mol. Its IUPAC name is diethyl 2-[(1S,2S)-1-cyclopropyl-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropyl]propanedioate.
| Compound Name | diethyl 2-[(1S,2S)-1-cyclopropyl-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropyl]propanedioate |
|---|---|
| PubChem CID | 71480410 |
| Molecular Formula | C22H37NO6 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | diethyl 2-[(1S,2S)-1-cyclopropyl-3-oxo-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H](C1CC1)[C@@H](C=O)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C22H37NO6/c1-7-27-19(25)18(20(26)28-8-2)17(15-10-11-15)16(14-24)29-23-21(3,4)12-9-13-22(23,5)6/h14-18H,7-13H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | QHLICYKAXVBVPK-IAGOWNOFSA-N |
| XLogP | 3.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|