C17H31NO3 — CID 62707645
3-methylbut-2-enyl 2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate (PubChem CID 62707645) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 3-methylbut-2-enyl 2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate.
| Compound Name | 3-methylbut-2-enyl 2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate |
|---|---|
| PubChem CID | 62707645 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 3-methylbut-2-enyl 2-(2,2,6,6-tetramethylpiperidin-1-yl)oxypropanoate |
| SMILES | CC(C)=CCOC(=O)C(C)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C17H31NO3/c1-13(2)9-12-20-15(19)14(3)21-18-16(4,5)10-8-11-17(18,6)7/h9,14H,8,10-12H2,1-7H3 |
| InChIKey | JMWGANMGHICGMZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|