C15H29BrN2O2 — CID 166722692
6-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexanamide (PubChem CID 166722692) has the molecular formula C15H29BrN2O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 6-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexanamide.
| Compound Name | 6-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexanamide |
|---|---|
| PubChem CID | 166722692 |
| Molecular Formula | C15H29BrN2O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 6-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyhexanamide |
| SMILES | CC1(C)CCCC(C)(C)N1ONC(=O)CCCCCBr |
| InChI | InChI=1S/C15H29BrN2O2/c1-14(2)10-8-11-15(3,4)18(14)20-17-13(19)9-6-5-7-12-16/h5-12H2,1-4H3,(H,17,19) |
| InChIKey | VZVWWPCOCMFHTM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|