C14H27BrN2O2 — CID 166722699
5-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanamide (PubChem CID 166722699) has the molecular formula C14H27BrN2O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 5-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanamide.
| Compound Name | 5-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanamide |
|---|---|
| PubChem CID | 166722699 |
| Molecular Formula | C14H27BrN2O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 5-bromo-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentanamide |
| SMILES | CC1(C)CCCC(C)(C)N1ONC(=O)CCCCBr |
| InChI | InChI=1S/C14H27BrN2O2/c1-13(2)9-7-10-14(3,4)17(13)19-16-12(18)8-5-6-11-15/h5-11H2,1-4H3,(H,16,18) |
| InChIKey | YSHCBPJOWUOOTE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|