C16H29BrN2O3 — CID 125425975
tert-butyl 5-(5-bromopentanoyl)-1,5-diazocane-1-carboxylate (PubChem CID 125425975) has the molecular formula C16H29BrN2O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is tert-butyl 5-(5-bromopentanoyl)-1,5-diazocane-1-carboxylate.
| Compound Name | tert-butyl 5-(5-bromopentanoyl)-1,5-diazocane-1-carboxylate |
|---|---|
| PubChem CID | 125425975 |
| Molecular Formula | C16H29BrN2O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | tert-butyl 5-(5-bromopentanoyl)-1,5-diazocane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)CCCCBr)CCC1 |
| InChI | InChI=1S/C16H29BrN2O3/c1-16(2,3)22-15(21)19-12-6-10-18(11-7-13-19)14(20)8-4-5-9-17/h4-13H2,1-3H3 |
| InChIKey | DRVHCLZCBXSPHC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|