About 5-bromopentyl piperidine-1-carboxylate
5-bromopentyl piperidine-1-carboxylate (PubChem CID 103970657) has the molecular formula C11H20BrNO2
and a molecular weight of 278.19 g/mol. Its IUPAC name is 5-bromopentyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 5-bromopentyl piperidine-1-carboxylate |
| PubChem CID | 103970657 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 5-bromopentyl piperidine-1-carboxylate |
| SMILES | O=C(OCCCCCBr)N1CCCCC1 |
| InChI | InChI=1S/C11H20BrNO2/c12-7-3-1-6-10-15-11(14)13-8-4-2-5-9-13/h1-10H2 |
| InChIKey | ZYJUJFHEDWDTSU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopentyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopentyl piperidine-1-carboxylate?
The IUPAC name of 5-bromopentyl piperidine-1-carboxylate (CID 103970657) is 5-bromopentyl piperidine-1-carboxylate.
What is the SMILES notation for 5-bromopentyl piperidine-1-carboxylate?
The canonical SMILES for 5-bromopentyl piperidine-1-carboxylate is O=C(OCCCCCBr)N1CCCCC1.
What is the InChIKey of 5-bromopentyl piperidine-1-carboxylate?
The InChIKey is ZYJUJFHEDWDTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrNO2/c12-7-3-1-6-10-15-11(14)13-8-4-2-5-9-13/h1-10H2.
What are the key properties of 5-bromopentyl piperidine-1-carboxylate?
5-bromopentyl piperidine-1-carboxylate has a molecular weight of 278.19 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopentyl piperidine-1-carboxylate is sourced from PubChem (CID 103970657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).