About 5-chloropentyl azepane-1-carboxylate
5-chloropentyl azepane-1-carboxylate (PubChem CID 103970757) has the molecular formula C12H22ClNO2
and a molecular weight of 247.77 g/mol. Its IUPAC name is 5-chloropentyl azepane-1-carboxylate.
Molecular Properties
| Compound Name | 5-chloropentyl azepane-1-carboxylate |
| PubChem CID | 103970757 |
| Molecular Formula | C12H22ClNO2 |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-chloropentyl azepane-1-carboxylate |
| SMILES | O=C(OCCCCCCl)N1CCCCCC1 |
| InChI | InChI=1S/C12H22ClNO2/c13-8-4-3-7-11-16-12(15)14-9-5-1-2-6-10-14/h1-11H2 |
| InChIKey | XLGIGJAOWVADRG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloropentyl azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloropentyl azepane-1-carboxylate?
The IUPAC name of 5-chloropentyl azepane-1-carboxylate (CID 103970757) is 5-chloropentyl azepane-1-carboxylate.
What is the SMILES notation for 5-chloropentyl azepane-1-carboxylate?
The canonical SMILES for 5-chloropentyl azepane-1-carboxylate is O=C(OCCCCCCl)N1CCCCCC1.
What is the InChIKey of 5-chloropentyl azepane-1-carboxylate?
The InChIKey is XLGIGJAOWVADRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClNO2/c13-8-4-3-7-11-16-12(15)14-9-5-1-2-6-10-14/h1-11H2.
What are the key properties of 5-chloropentyl azepane-1-carboxylate?
5-chloropentyl azepane-1-carboxylate has a molecular weight of 247.77 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloropentyl azepane-1-carboxylate is sourced from PubChem (CID 103970757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).