C24H41NO5 — CID 102023050
diethyl (2S)-2-[(E)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 102023050) has the molecular formula C24H41NO5 and a molecular weight of 423.59 g/mol. Its IUPAC name is diethyl (2S)-2-[(E)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (2S)-2-[(E)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102023050 |
| Molecular Formula | C24H41NO5 |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | diethyl (2S)-2-[(E)-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxybut-2-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | C/C=C/C(ON1C(C)(C)CCCC1(C)C)[C@H]1CCCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H41NO5/c1-8-13-19(30-25-22(4,5)15-12-16-23(25,6)7)18-14-11-17-24(18,20(26)28-9-2)21(27)29-10-3/h8,13,18-19H,9-12,14-17H2,1-7H3/b13-8+/t18-,19?/m1/s1 |
| InChIKey | SPMWZOBFQWZUEG-SKVRJZRMSA-N |
| XLogP | 4.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|