C14H23ClO4 — CID 11044491
diethyl 2-(2-chloropropan-2-yl)cyclopentane-1,1-dicarboxylate (PubChem CID 11044491) has the molecular formula C14H23ClO4 and a molecular weight of 290.79 g/mol. Its IUPAC name is diethyl 2-(2-chloropropan-2-yl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 2-(2-chloropropan-2-yl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11044491 |
| Molecular Formula | C14H23ClO4 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | diethyl 2-(2-chloropropan-2-yl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCC1C(C)(C)Cl |
| InChI | InChI=1S/C14H23ClO4/c1-5-18-11(16)14(12(17)19-6-2)9-7-8-10(14)13(3,4)15/h10H,5-9H2,1-4H3 |
| InChIKey | HVEWHRWDAXVSNR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|