C19H32N2O3 — CID 23326846
[4-cyano-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentyl] 2-methylprop-2-enoate (PubChem CID 23326846) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is [4-cyano-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentyl] 2-methylprop-2-enoate.
| Compound Name | [4-cyano-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23326846 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | [4-cyano-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(C)(C#N)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C19H32N2O3/c1-15(2)16(22)23-13-9-12-19(7,14-20)24-21-17(3,4)10-8-11-18(21,5)6/h1,8-13H2,2-7H3 |
| InChIKey | JBPNNOWANSUTIA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|