C10H22O3Si2 — CID 173295431
(4-methyl-4-silyloxysilylpentyl) 2-methylprop-2-enoate (PubChem CID 173295431) has the molecular formula C10H22O3Si2 and a molecular weight of 246.45 g/mol. Its IUPAC name is (4-methyl-4-silyloxysilylpentyl) 2-methylprop-2-enoate.
| Compound Name | (4-methyl-4-silyloxysilylpentyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173295431 |
| Molecular Formula | C10H22O3Si2 |
| Molecular Weight | 246.45 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (4-methyl-4-silyloxysilylpentyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(C)(C)[SiH2]O[SiH3] |
| InChI | InChI=1S/C10H22O3Si2/c1-8(2)9(11)12-7-5-6-10(3,4)15-13-14/h1,5-7,15H2,2-4,14H3 |
| InChIKey | PWNFJGGVSHBVCF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|