C25H28NO7PS — CID 102241822
(2-sulfanylidene-1-pyridinyl) 2-(diphenoxyphosphoryloxymethyl)-2-methoxy-3,3-dimethylbutanoate (PubChem CID 102241822) has the molecular formula C25H28NO7PS and a molecular weight of 517.54 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 2-(diphenoxyphosphoryloxymethyl)-2-methoxy-3,3-dimethylbutanoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 2-(diphenoxyphosphoryloxymethyl)-2-methoxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 102241822 |
| Molecular Formula | C25H28NO7PS |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 2-(diphenoxyphosphoryloxymethyl)-2-methoxy-3,3-dimethylbutanoate |
| SMILES | COC(COP(=O)(Oc1ccccc1)Oc1ccccc1)(C(=O)On1ccccc1=S)C(C)(C)C |
| InChI | InChI=1S/C25H28NO7PS/c1-24(2,3)25(29-4,23(27)31-26-18-12-11-17-22(26)35)19-30-34(28,32-20-13-7-5-8-14-20)33-21-15-9-6-10-16-21/h5-18H,19H2,1-4H3 |
| InChIKey | NOVNUVNSLKVFSP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|