C18H29NO2S — CID 100956559
(2-sulfanylidene-1-pyridinyl) 2,2-dimethylundecanoate (PubChem CID 100956559) has the molecular formula C18H29NO2S and a molecular weight of 323.50 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 2,2-dimethylundecanoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 2,2-dimethylundecanoate |
|---|---|
| PubChem CID | 100956559 |
| Molecular Formula | C18H29NO2S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 2,2-dimethylundecanoate |
| SMILES | CCCCCCCCCC(C)(C)C(=O)On1ccccc1=S |
| InChI | InChI=1S/C18H29NO2S/c1-4-5-6-7-8-9-11-14-18(2,3)17(20)21-19-15-12-10-13-16(19)22/h10,12-13,15H,4-9,11,14H2,1-3H3 |
| InChIKey | JXPJHYIGWKDCGV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|