C14H21NO2S3 — CID 10336832
(2-sulfanylidene-1-pyridinyl) 5-(tert-butyldisulfanyl)pentanoate (PubChem CID 10336832) has the molecular formula C14H21NO2S3 and a molecular weight of 331.53 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 5-(tert-butyldisulfanyl)pentanoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 5-(tert-butyldisulfanyl)pentanoate |
|---|---|
| PubChem CID | 10336832 |
| Molecular Formula | C14H21NO2S3 |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 5-(tert-butyldisulfanyl)pentanoate |
| SMILES | CC(C)(C)SSCCCCC(=O)On1ccccc1=S |
| InChI | InChI=1S/C14H21NO2S3/c1-14(2,3)20-19-11-7-5-9-13(16)17-15-10-6-4-8-12(15)18/h4,6,8,10H,5,7,9,11H2,1-3H3 |
| InChIKey | AVQMTTIFYVBIDZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|