C12H13NO2S — CID 102356414
(2-sulfanylidene-1-pyridinyl) (3E)-5-methylhexa-3,5-dienoate (PubChem CID 102356414) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) (3E)-5-methylhexa-3,5-dienoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) (3E)-5-methylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 102356414 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) (3E)-5-methylhexa-3,5-dienoate |
| SMILES | C=C(C)/C=C/CC(=O)On1ccccc1=S |
| InChI | InChI=1S/C12H13NO2S/c1-10(2)6-5-8-12(14)15-13-9-4-3-7-11(13)16/h3-7,9H,1,8H2,2H3/b6-5+ |
| InChIKey | YEIIBDRRVHCUKD-AATRIKPKSA-N |
| XLogP | 2.70 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|