C11H15NO2S — CID 71321556
(2-sulfanylidene-1-pyridinyl) 3,3-dimethylbutanoate (PubChem CID 71321556) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 3,3-dimethylbutanoate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 71321556 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)On1ccccc1=S |
| InChI | InChI=1S/C11H15NO2S/c1-11(2,3)8-10(13)14-12-7-5-4-6-9(12)15/h4-7H,8H2,1-3H3 |
| InChIKey | WJLNRTBHCWHVBD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|