C16H14FNO2S — CID 101035768
(2-sulfanylidene-1-pyridinyl) 2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]acetate (PubChem CID 101035768) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is (2-sulfanylidene-1-pyridinyl) 2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]acetate.
| Compound Name | (2-sulfanylidene-1-pyridinyl) 2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 101035768 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2-sulfanylidene-1-pyridinyl) 2-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]acetate |
| SMILES | O=C(C[C@H]1C[C@@H]1c1ccc(F)cc1)On1ccccc1=S |
| InChI | InChI=1S/C16H14FNO2S/c17-13-6-4-11(5-7-13)14-9-12(14)10-16(19)20-18-8-2-1-3-15(18)21/h1-8,12,14H,9-10H2/t12-,14-/m1/s1 |
| InChIKey | OILJTUZQIZXQRT-TZMCWYRMSA-N |
| XLogP | 3.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|