C25H25FO4 — CID 145368277
benzene;(4-fluorophenyl)methyl (2R)-2-phenylcyclobutane-1-carboxylate;formic acid (PubChem CID 145368277) has the molecular formula C25H25FO4 and a molecular weight of 408.47 g/mol. Its IUPAC name is benzene;(4-fluorophenyl)methyl (2R)-2-phenylcyclobutane-1-carboxylate;formic acid.
| Compound Name | benzene;(4-fluorophenyl)methyl (2R)-2-phenylcyclobutane-1-carboxylate;formic acid |
|---|---|
| PubChem CID | 145368277 |
| Molecular Formula | C25H25FO4 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | benzene;(4-fluorophenyl)methyl (2R)-2-phenylcyclobutane-1-carboxylate;formic acid |
| SMILES | O=C(OCc1ccc(F)cc1)C1CC[C@H]1c1ccccc1.O=CO.c1ccccc1 |
| InChI | InChI=1S/C18H17FO2.C6H6.CH2O2/c19-15-8-6-13(7-9-15)12-21-18(20)17-11-10-16(17)14-4-2-1-3-5-14;1-2-4-6-5-3-1;2-1-3/h1-9,16-17H,10-12H2;1-6H;1H,(H,2,3)/t16-,17?;;/m0../s1 |
| InChIKey | HCOXJPSOLLWOIO-VEEDUFMYSA-N |
| XLogP | 5.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|