C20H20O2 — CID 145368316
2,3-dihydro-1H-inden-2-yl (1R)-2-phenylcyclobutane-1-carboxylate (PubChem CID 145368316) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl (1R)-2-phenylcyclobutane-1-carboxylate.
| Compound Name | 2,3-dihydro-1H-inden-2-yl (1R)-2-phenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 145368316 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl (1R)-2-phenylcyclobutane-1-carboxylate |
| SMILES | O=C(OC1Cc2ccccc2C1)[C@@H]1CCC1c1ccccc1 |
| InChI | InChI=1S/C20H20O2/c21-20(19-11-10-18(19)14-6-2-1-3-7-14)22-17-12-15-8-4-5-9-16(15)13-17/h1-9,17-19H,10-13H2/t18?,19-/m1/s1 |
| InChIKey | UQWXELBMHCGUBX-MUMRKEEXSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |