C26H40NO2+ — CID 10481959
[(1R,5S)-8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohexane-1-carboxylate (PubChem CID 10481959) has the molecular formula C26H40NO2+ and a molecular weight of 398.61 g/mol. Its IUPAC name is [(1R,5S)-8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohexane-1-carboxylate.
| Compound Name | [(1R,5S)-8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10481959 |
| Molecular Formula | C26H40NO2+ |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | [(1R,5S)-8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohexane-1-carboxylate |
| SMILES | CCC[N+]1(C(C)C)[C@@H]2CC[C@H]1CC(OC(=O)C1CCCCC1c1ccccc1)C2 |
| InChI | InChI=1S/C26H40NO2/c1-4-16-27(19(2)3)21-14-15-22(27)18-23(17-21)29-26(28)25-13-9-8-12-24(25)20-10-6-5-7-11-20/h5-7,10-11,19,21-25H,4,8-9,12-18H2,1-3H3/q+1/t21-,22+,23?,24?,25?,27? |
| InChIKey | ARTVJDBSNKYRGJ-COBLALJISA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|