C25H36BrNO2 — CID 10004524
[(1R,5S)-8-ethyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide (PubChem CID 10004524) has the molecular formula C25H36BrNO2 and a molecular weight of 462.47 g/mol. Its IUPAC name is [(1R,5S)-8-ethyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide.
| Compound Name | [(1R,5S)-8-ethyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide |
|---|---|
| PubChem CID | 10004524 |
| Molecular Formula | C25H36BrNO2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [(1R,5S)-8-ethyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide |
| SMILES | CC[N+]1(C(C)C)[C@@H]2CC[C@H]1CC(OC(=O)C1CCCC=C1c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C25H36NO2.BrH/c1-4-26(18(2)3)20-14-15-21(26)17-22(16-20)28-25(27)24-13-9-8-12-23(24)19-10-6-5-7-11-19;/h5-7,10-12,18,20-22,24H,4,8-9,13-17H2,1-3H3;1H/q+1;/p-1/t20-,21+,22?,24?,26?; |
| InChIKey | GEYOZBOJTBAYGW-HYDGRJICSA-M |
| XLogP | 2.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|