C26H36NO2+ — CID 70350870
(8-cyclopropyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-phenylcyclohex-2-ene-1-carboxylate (PubChem CID 70350870) has the molecular formula C26H36NO2+ and a molecular weight of 394.58 g/mol. Its IUPAC name is (8-cyclopropyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-phenylcyclohex-2-ene-1-carboxylate.
| Compound Name | (8-cyclopropyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-phenylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 70350870 |
| Molecular Formula | C26H36NO2+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | (8-cyclopropyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-phenylcyclohex-2-ene-1-carboxylate |
| SMILES | CC(C)[N+]1(C2CC2)C2CCC1CC(OC(=O)C1CCCC=C1c1ccccc1)C2 |
| InChI | InChI=1S/C26H36NO2/c1-18(2)27(20-12-13-20)21-14-15-22(27)17-23(16-21)29-26(28)25-11-7-6-10-24(25)19-8-4-3-5-9-19/h3-5,8-10,18,20-23,25H,6-7,11-17H2,1-2H3/q+1 |
| InChIKey | KHSUYROIVRLVKM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|