C27H40NO2+ — CID 70350868
(8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(2-phenylcyclohexen-1-yl)acetate (PubChem CID 70350868) has the molecular formula C27H40NO2+ and a molecular weight of 410.62 g/mol. Its IUPAC name is (8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(2-phenylcyclohexen-1-yl)acetate.
| Compound Name | (8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(2-phenylcyclohexen-1-yl)acetate |
|---|---|
| PubChem CID | 70350868 |
| Molecular Formula | C27H40NO2+ |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | (8-propan-2-yl-8-propyl-8-azoniabicyclo[3.2.1]octan-3-yl) 2-(2-phenylcyclohexen-1-yl)acetate |
| SMILES | CCC[N+]1(C(C)C)C2CCC1CC(OC(=O)CC1=C(c3ccccc3)CCCC1)C2 |
| InChI | InChI=1S/C27H40NO2/c1-4-16-28(20(2)3)23-14-15-24(28)19-25(18-23)30-27(29)17-22-12-8-9-13-26(22)21-10-6-5-7-11-21/h5-7,10-11,20,23-25H,4,8-9,12-19H2,1-3H3/q+1 |
| InChIKey | PQCHPKHNGYTNJM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|